C32H37Cl2N3 — CID 127046554
1-(2-adamantyl)-4-[[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]methyl]piperazine (PubChem CID 127046554) has the molecular formula C32H37Cl2N3 and a molecular weight of 534.58 g/mol. Its IUPAC name is 1-(2-adamantyl)-4-[[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]methyl]piperazine.
| Compound Name | 1-(2-adamantyl)-4-[[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]methyl]piperazine |
|---|---|
| PubChem CID | 127046554 |
| Molecular Formula | C32H37Cl2N3 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 1-(2-adamantyl)-4-[[1,5-bis(4-chlorophenyl)-2-methylpyrrol-3-yl]methyl]piperazine |
| SMILES | Cc1c(CN2CCN(C3C4CC5CC(C4)CC3C5)CC2)cc(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H37Cl2N3/c1-21-27(19-31(24-2-4-28(33)5-3-24)37(21)30-8-6-29(34)7-9-30)20-35-10-12-36(13-11-35)32-25-15-22-14-23(17-25)18-26(32)16-22/h2-9,19,22-23,25-26,32H,10-18,20H2,1H3 |
| InChIKey | HKTPHLZUUBGEHN-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|