C28H24O5 — CID 12704706
dimethyl 12-oxo-10,11-diphenyltricyclo[7.2.1.02,8]dodeca-3,5,10-triene-1,9-dicarboxylate (PubChem CID 12704706) has the molecular formula C28H24O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is dimethyl 12-oxo-10,11-diphenyltricyclo[7.2.1.02,8]dodeca-3,5,10-triene-1,9-dicarboxylate.
| Compound Name | dimethyl 12-oxo-10,11-diphenyltricyclo[7.2.1.02,8]dodeca-3,5,10-triene-1,9-dicarboxylate |
|---|---|
| PubChem CID | 12704706 |
| Molecular Formula | C28H24O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | dimethyl 12-oxo-10,11-diphenyltricyclo[7.2.1.02,8]dodeca-3,5,10-triene-1,9-dicarboxylate |
| SMILES | COC(=O)C12C(=O)C(C(=O)OC)(C(c3ccccc3)=C1c1ccccc1)C1CC=CC=CC12 |
| InChI | InChI=1S/C28H24O5/c1-32-25(30)27-20-16-10-5-11-17-21(20)28(24(27)29,26(31)33-2)23(19-14-8-4-9-15-19)22(27)18-12-6-3-7-13-18/h3-16,20-21H,17H2,1-2H3 |
| InChIKey | CFJSYFUZDITQHY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|