C11H7N5O2 — CID 127048474
10-nitropyrido[3,4-g]quinazolin-2-amine (PubChem CID 127048474) has the molecular formula C11H7N5O2 and a molecular weight of 241.21 g/mol. Its IUPAC name is 10-nitropyrido[3,4-g]quinazolin-2-amine.
| Compound Name | 10-nitropyrido[3,4-g]quinazolin-2-amine |
|---|---|
| PubChem CID | 127048474 |
| Molecular Formula | C11H7N5O2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 10-nitropyrido[3,4-g]quinazolin-2-amine |
| SMILES | Nc1ncc2cc3cnccc3c([N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C11H7N5O2/c12-11-14-5-7-3-6-4-13-2-1-8(6)10(16(17)18)9(7)15-11/h1-5H,(H2,12,14,15) |
| InChIKey | YHUAZSANAXCOGS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|