C15H23IN6O3 — CID 127049770
(2S)-2-[[(2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanamide (PubChem CID 127049770) has the molecular formula C15H23IN6O3 and a molecular weight of 462.29 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 127049770 |
| Molecular Formula | C15H23IN6O3 |
| Molecular Weight | 462.29 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanamide |
| SMILES | NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)Cc1ccc(O)c(I)c1 |
| InChI | InChI=1S/C15H23IN6O3/c16-9-6-8(3-4-12(9)23)7-10(17)14(25)22-11(13(18)24)2-1-5-21-15(19)20/h3-4,6,10-11,23H,1-2,5,7,17H2,(H2,18,24)(H,22,25)(H4,19,20,21)/t10-,11-/m0/s1 |
| InChIKey | IPBWDKWKMWRHIY-QWRGUYRKSA-N |
| XLogP | -1.11 |
| TPSA | 182.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.29 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|