C20H32O4 — CID 127051544
4-[[(2R,4aS,4bS,7R,8aS,10aR)-4a,7-dimethyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl]oxy]-4-oxobutanoic acid (PubChem CID 127051544) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 4-[[(2R,4aS,4bS,7R,8aS,10aR)-4a,7-dimethyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(2R,4aS,4bS,7R,8aS,10aR)-4a,7-dimethyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 127051544 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 4-[[(2R,4aS,4bS,7R,8aS,10aR)-4a,7-dimethyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl]oxy]-4-oxobutanoic acid |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](CC[C@@H]3C[C@H](OC(=O)CCC(=O)O)CC[C@@]32C)C1 |
| InChI | InChI=1S/C20H32O4/c1-13-3-6-17-14(11-13)4-5-15-12-16(9-10-20(15,17)2)24-19(23)8-7-18(21)22/h13-17H,3-12H2,1-2H3,(H,21,22)/t13-,14+,15-,16-,17+,20+/m1/s1 |
| InChIKey | SQMULUMIKGAUHR-IRODIIKFSA-N |
| XLogP | 4.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |