C25H34O5 — CID 127054604
(1R,4aR,5R,8aS)-1-(1,3-dioxolan-2-ylmethyl)-5-[(4-methoxyphenyl)methoxymethyl]-5,8a-dimethyl-3,4,4a,8-tetrahydro-1H-naphthalen-2-one (PubChem CID 127054604) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is (1R,4aR,5R,8aS)-1-(1,3-dioxolan-2-ylmethyl)-5-[(4-methoxyphenyl)methoxymethyl]-5,8a-dimethyl-3,4,4a,8-tetrahydro-1H-naphthalen-2-one.
| Compound Name | (1R,4aR,5R,8aS)-1-(1,3-dioxolan-2-ylmethyl)-5-[(4-methoxyphenyl)methoxymethyl]-5,8a-dimethyl-3,4,4a,8-tetrahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 127054604 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (1R,4aR,5R,8aS)-1-(1,3-dioxolan-2-ylmethyl)-5-[(4-methoxyphenyl)methoxymethyl]-5,8a-dimethyl-3,4,4a,8-tetrahydro-1H-naphthalen-2-one |
| SMILES | COc1ccc(COC[C@]2(C)C=CC[C@@]3(C)[C@H]2CCC(=O)[C@@H]3CC2OCCO2)cc1 |
| InChI | InChI=1S/C25H34O5/c1-24(17-28-16-18-5-7-19(27-3)8-6-18)11-4-12-25(2)20(15-23-29-13-14-30-23)21(26)9-10-22(24)25/h4-8,11,20,22-23H,9-10,12-17H2,1-3H3/t20-,22-,24-,25+/m0/s1 |
| InChIKey | LIZMEUAJIRVNCY-GIALRWNJSA-N |
| XLogP | 4.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|