C15H17N3O2 — CID 12720264
5,5,7,7-tetramethyl-1-oxido-3-phenylfuro[3,4-e][1,2,4]triazin-1-ium (PubChem CID 12720264) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 5,5,7,7-tetramethyl-1-oxido-3-phenylfuro[3,4-e][1,2,4]triazin-1-ium.
| Compound Name | 5,5,7,7-tetramethyl-1-oxido-3-phenylfuro[3,4-e][1,2,4]triazin-1-ium |
|---|---|
| PubChem CID | 12720264 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 5,5,7,7-tetramethyl-1-oxido-3-phenylfuro[3,4-e][1,2,4]triazin-1-ium |
| SMILES | CC1(C)OC(C)(C)c2c1nc(-c1ccccc1)n[n+]2[O-] |
| InChI | InChI=1S/C15H17N3O2/c1-14(2)11-12(15(3,4)20-14)18(19)17-13(16-11)10-8-6-5-7-9-10/h5-9H,1-4H3 |
| InChIKey | SYMRTNBHCYOSKI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|