C16H29N5O — CID 127254601
N-octyl-1-(tetrazol-1-yl)cyclohexane-1-carboxamide (PubChem CID 127254601) has the molecular formula C16H29N5O and a molecular weight of 307.44 g/mol. Its IUPAC name is N-octyl-1-(tetrazol-1-yl)cyclohexane-1-carboxamide.
| Compound Name | N-octyl-1-(tetrazol-1-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 127254601 |
| Molecular Formula | C16H29N5O |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.24 |
| IUPAC Name | N-octyl-1-(tetrazol-1-yl)cyclohexane-1-carboxamide |
| SMILES | CCCCCCCCNC(=O)C1(n2cnnn2)CCCCC1 |
| InChI | InChI=1S/C16H29N5O/c1-2-3-4-5-6-10-13-17-15(22)16(11-8-7-9-12-16)21-14-18-19-20-21/h14H,2-13H2,1H3,(H,17,22) |
| InChIKey | CFWWWEBFNVWVMW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|