C12H11N5 — CID 127261754
1-imidazo[1,2-b]pyridazin-6-yl-2-phenylhydrazine (PubChem CID 127261754) has the molecular formula C12H11N5 and a molecular weight of 225.26 g/mol. Its IUPAC name is 1-imidazo[1,2-b]pyridazin-6-yl-2-phenylhydrazine.
| Compound Name | 1-imidazo[1,2-b]pyridazin-6-yl-2-phenylhydrazine |
|---|---|
| PubChem CID | 127261754 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1-imidazo[1,2-b]pyridazin-6-yl-2-phenylhydrazine |
| SMILES | c1ccc(NNc2ccc3nccn3n2)cc1 |
| InChI | InChI=1S/C12H11N5/c1-2-4-10(5-3-1)14-15-11-6-7-12-13-8-9-17(12)16-11/h1-9,14H,(H,15,16) |
| InChIKey | GDHQTKBLJIFQFK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|