C9H12N4S — CID 130718345
N-(2-methylsulfanylethyl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 130718345) has the molecular formula C9H12N4S and a molecular weight of 208.29 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | N-(2-methylsulfanylethyl)imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 130718345 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N-(2-methylsulfanylethyl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | CSCCNc1ccc2nccn2n1 |
| InChI | InChI=1S/C9H12N4S/c1-14-7-5-10-8-2-3-9-11-4-6-13(9)12-8/h2-4,6H,5,7H2,1H3,(H,10,12) |
| InChIKey | MZBIOAZFTYKAGQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|