C12H17BrN2O — CID 127264014
2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide (PubChem CID 127264014) has the molecular formula C12H17BrN2O and a molecular weight of 285.19 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide.
| Compound Name | 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide |
|---|---|
| PubChem CID | 127264014 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-(4-bromophenyl)-N'-hydroxy-2,3-dimethylbutanimidamide |
| SMILES | CC(C)C(C)(/C(N)=N\O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H17BrN2O/c1-8(2)12(3,11(14)15-16)9-4-6-10(13)7-5-9/h4-8,16H,1-3H3,(H2,14,15) |
| InChIKey | YUNDJJOKSVASCH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|