C17H32N2O3S — CID 127265050
N-[[1-(3,4,4-trimethylpent-2-enoyl)piperidin-3-yl]methyl]propane-2-sulfonamide (PubChem CID 127265050) has the molecular formula C17H32N2O3S and a molecular weight of 344.52 g/mol. Its IUPAC name is N-[[1-(3,4,4-trimethylpent-2-enoyl)piperidin-3-yl]methyl]propane-2-sulfonamide.
| Compound Name | N-[[1-(3,4,4-trimethylpent-2-enoyl)piperidin-3-yl]methyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 127265050 |
| Molecular Formula | C17H32N2O3S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-[[1-(3,4,4-trimethylpent-2-enoyl)piperidin-3-yl]methyl]propane-2-sulfonamide |
| SMILES | CC(=CC(=O)N1CCCC(CNS(=O)(=O)C(C)C)C1)C(C)(C)C |
| InChI | InChI=1S/C17H32N2O3S/c1-13(2)23(21,22)18-11-15-8-7-9-19(12-15)16(20)10-14(3)17(4,5)6/h10,13,15,18H,7-9,11-12H2,1-6H3 |
| InChIKey | QINQGBXTVUGFCF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|