C14H27N3O3S — CID 25456204
(3S)-3-[(dimethylsulfamoylamino)methyl]-1-[(E)-4-methylpent-2-enoyl]piperidine (PubChem CID 25456204) has the molecular formula C14H27N3O3S and a molecular weight of 317.46 g/mol. Its IUPAC name is (3S)-3-[(dimethylsulfamoylamino)methyl]-1-[(E)-4-methylpent-2-enoyl]piperidine.
| Compound Name | (3S)-3-[(dimethylsulfamoylamino)methyl]-1-[(E)-4-methylpent-2-enoyl]piperidine |
|---|---|
| PubChem CID | 25456204 |
| Molecular Formula | C14H27N3O3S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (3S)-3-[(dimethylsulfamoylamino)methyl]-1-[(E)-4-methylpent-2-enoyl]piperidine |
| SMILES | CC(C)/C=C/C(=O)N1CCC[C@H](CNS(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C14H27N3O3S/c1-12(2)7-8-14(18)17-9-5-6-13(11-17)10-15-21(19,20)16(3)4/h7-8,12-13,15H,5-6,9-11H2,1-4H3/b8-7+/t13-/m1/s1 |
| InChIKey | VAHAOMMYTLGHMH-SBDDDAINSA-N |
| XLogP | 0.83 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|