About N-(1-acetyl-2,3-dihydroindol-5-yl)-4-(2-oxopyrrolidin-1-yl)piperidine-1-carboxamide
N-(1-acetyl-2,3-dihydroindol-5-yl)-4-(2-oxopyrrolidin-1-yl)piperidine-1-carboxamide (PubChem CID 127286144) has the molecular formula C20H26N4O3
and a molecular weight of 370.45 g/mol. Its IUPAC name is N-(1-acetyl-2,3-dihydroindol-5-yl)-4-(2-oxopyrrolidin-1-yl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-4-(2-oxopyrrolidin-1-yl)piperidine-1-carboxamide |
| PubChem CID | 127286144 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-4-(2-oxopyrrolidin-1-yl)piperidine-1-carboxamide |
| SMILES | CC(=O)N1CCc2cc(NC(=O)N3CCC(N4CCCC4=O)CC3)ccc21 |
| InChI | InChI=1S/C20H26N4O3/c1-14(25)23-12-6-15-13-16(4-5-18(15)23)21-20(27)22-10-7-17(8-11-22)24-9-2-3-19(24)26/h4-5,13,17H,2-3,6-12H2,1H3,(H,21,27) |
| InChIKey | GLIRMNKGGWBFMJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-acetyl-2,3-dihydroindol-5-yl)-4-(2-oxopyrrolidin-1-yl)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-acetyl-2,3-dihydroindol-5-yl)-4-(2-oxopyrrolidin-1-yl)piperidine-1-carboxamide?
The IUPAC name of N-(1-acetyl-2,3-dihydroindol-5-yl)-4-(2-oxopyrrolidin-1-yl)piperidine-1-carboxamide (CID 127286144) is N-(1-acetyl-2,3-dihydroindol-5-yl)-4-(2-oxopyrrolidin-1-yl)piperidine-1-carboxamide.
What is the SMILES notation for N-(1-acetyl-2,3-dihydroindol-5-yl)-4-(2-oxopyrrolidin-1-yl)piperidine-1-carboxamide?
The canonical SMILES for N-(1-acetyl-2,3-dihydroindol-5-yl)-4-(2-oxopyrrolidin-1-yl)piperidine-1-carboxamide is CC(=O)N1CCc2cc(NC(=O)N3CCC(N4CCCC4=O)CC3)ccc21.
What is the InChIKey of N-(1-acetyl-2,3-dihydroindol-5-yl)-4-(2-oxopyrrolidin-1-yl)piperidine-1-carboxamide?
The InChIKey is GLIRMNKGGWBFMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O3/c1-14(25)23-12-6-15-13-16(4-5-18(15)23)21-20(27)22-10-7-17(8-11-22)24-9-2-3-19(24)26/h4-5,13,17H,2-3,6-12H2,1H3,(H,21,27).
What are the key properties of N-(1-acetyl-2,3-dihydroindol-5-yl)-4-(2-oxopyrrolidin-1-yl)piperidine-1-carboxamide?
N-(1-acetyl-2,3-dihydroindol-5-yl)-4-(2-oxopyrrolidin-1-yl)piperidine-1-carboxamide has a molecular weight of 370.45 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-acetyl-2,3-dihydroindol-5-yl)-4-(2-oxopyrrolidin-1-yl)piperidine-1-carboxamide is sourced from PubChem (CID 127286144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).