C16H15N3O2S — CID 127391595
N-(4-cyanooxan-4-yl)-3-phenyl-1,2-thiazole-5-carboxamide (PubChem CID 127391595) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is N-(4-cyanooxan-4-yl)-3-phenyl-1,2-thiazole-5-carboxamide.
| Compound Name | N-(4-cyanooxan-4-yl)-3-phenyl-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 127391595 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-(4-cyanooxan-4-yl)-3-phenyl-1,2-thiazole-5-carboxamide |
| SMILES | N#CC1(NC(=O)c2cc(-c3ccccc3)ns2)CCOCC1 |
| InChI | InChI=1S/C16H15N3O2S/c17-11-16(6-8-21-9-7-16)18-15(20)14-10-13(19-22-14)12-4-2-1-3-5-12/h1-5,10H,6-9H2,(H,18,20) |
| InChIKey | BLTMEIYZOSZBJX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |