C16H19N3O4 — CID 12741099
1-(1-ethoxy-2-oxocyclohexyl)-4-phenyl-1,2,4-triazolidine-3,5-dione (PubChem CID 12741099) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is 1-(1-ethoxy-2-oxocyclohexyl)-4-phenyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1-(1-ethoxy-2-oxocyclohexyl)-4-phenyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 12741099 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-(1-ethoxy-2-oxocyclohexyl)-4-phenyl-1,2,4-triazolidine-3,5-dione |
| SMILES | CCOC1(n2[nH]c(=O)n(-c3ccccc3)c2=O)CCCCC1=O |
| InChI | InChI=1S/C16H19N3O4/c1-2-23-16(11-7-6-10-13(16)20)19-15(22)18(14(21)17-19)12-8-4-3-5-9-12/h3-5,8-9H,2,6-7,10-11H2,1H3,(H,17,21) |
| InChIKey | JYXGRDBZTUGOSY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |