C12H18O2 — CID 12741721
3,4-dimethyl-5-pentylfuran-2-carbaldehyde (PubChem CID 12741721) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 3,4-dimethyl-5-pentylfuran-2-carbaldehyde.
| Compound Name | 3,4-dimethyl-5-pentylfuran-2-carbaldehyde |
|---|---|
| PubChem CID | 12741721 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3,4-dimethyl-5-pentylfuran-2-carbaldehyde |
| SMILES | CCCCCc1oc(C=O)c(C)c1C |
| InChI | InChI=1S/C12H18O2/c1-4-5-6-7-11-9(2)10(3)12(8-13)14-11/h8H,4-7H2,1-3H3 |
| InChIKey | MFLSSLCRQQYESG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|