About 3-methyl-5-pentoxyfuran-2-carbaldehyde;methylsulfinylmethane
3-methyl-5-pentoxyfuran-2-carbaldehyde;methylsulfinylmethane (PubChem CID 174554206) has the molecular formula C13H22O4S
and a molecular weight of 274.38 g/mol. Its IUPAC name is 3-methyl-5-pentoxyfuran-2-carbaldehyde;methylsulfinylmethane.
Molecular Properties
| Compound Name | 3-methyl-5-pentoxyfuran-2-carbaldehyde;methylsulfinylmethane |
| PubChem CID | 174554206 |
| Molecular Formula | C13H22O4S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-methyl-5-pentoxyfuran-2-carbaldehyde;methylsulfinylmethane |
| SMILES | CCCCCOc1cc(C)c(C=O)o1.CS(C)=O |
| InChI | InChI=1S/C11H16O3.C2H6OS/c1-3-4-5-6-13-11-7-9(2)10(8-12)14-11;1-4(2)3/h7-8H,3-6H2,1-2H3;1-2H3 |
| InChIKey | FTNNGGYUCYCFLZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5-pentoxyfuran-2-carbaldehyde;methylsulfinylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-pentoxyfuran-2-carbaldehyde;methylsulfinylmethane?
The IUPAC name of 3-methyl-5-pentoxyfuran-2-carbaldehyde;methylsulfinylmethane (CID 174554206) is 3-methyl-5-pentoxyfuran-2-carbaldehyde;methylsulfinylmethane.
What is the SMILES notation for 3-methyl-5-pentoxyfuran-2-carbaldehyde;methylsulfinylmethane?
The canonical SMILES for 3-methyl-5-pentoxyfuran-2-carbaldehyde;methylsulfinylmethane is CCCCCOc1cc(C)c(C=O)o1.CS(C)=O.
What is the InChIKey of 3-methyl-5-pentoxyfuran-2-carbaldehyde;methylsulfinylmethane?
The InChIKey is FTNNGGYUCYCFLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3.C2H6OS/c1-3-4-5-6-13-11-7-9(2)10(8-12)14-11;1-4(2)3/h7-8H,3-6H2,1-2H3;1-2H3.
What are the key properties of 3-methyl-5-pentoxyfuran-2-carbaldehyde;methylsulfinylmethane?
3-methyl-5-pentoxyfuran-2-carbaldehyde;methylsulfinylmethane has a molecular weight of 274.38 g/mol, XLogP of 2.96, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-pentoxyfuran-2-carbaldehyde;methylsulfinylmethane is sourced from PubChem (CID 174554206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).