C26H36O5 — CID 23425703
2-[(2S,4R)-4-(3,5-dimethyl-4-oxo-6-pentylpyran-2-yl)-3-oxopentan-2-yl]-6-ethyl-3,5-dimethylpyran-4-one (PubChem CID 23425703) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is 2-[(2S,4R)-4-(3,5-dimethyl-4-oxo-6-pentylpyran-2-yl)-3-oxopentan-2-yl]-6-ethyl-3,5-dimethylpyran-4-one.
| Compound Name | 2-[(2S,4R)-4-(3,5-dimethyl-4-oxo-6-pentylpyran-2-yl)-3-oxopentan-2-yl]-6-ethyl-3,5-dimethylpyran-4-one |
|---|---|
| PubChem CID | 23425703 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 2-[(2S,4R)-4-(3,5-dimethyl-4-oxo-6-pentylpyran-2-yl)-3-oxopentan-2-yl]-6-ethyl-3,5-dimethylpyran-4-one |
| SMILES | CCCCCc1oc([C@@H](C)C(=O)[C@@H](C)c2oc(CC)c(C)c(=O)c2C)c(C)c(=O)c1C |
| InChI | InChI=1S/C26H36O5/c1-9-11-12-13-21-15(4)23(28)17(6)26(31-21)19(8)24(29)18(7)25-16(5)22(27)14(3)20(10-2)30-25/h18-19H,9-13H2,1-8H3/t18-,19+/m1/s1 |
| InChIKey | SCKPNHOSGIUHAB-MOPGFXCFSA-N |
| XLogP | 5.60 |
| TPSA | 77.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|