C32H48O7 — CID 163090432
2-[(E,2R,3R,4R,5S,8S)-3,5-dihydroxy-8-[6-[(2R,3R)-3-hydroxypentan-2-yl]-3,5-dimethyl-4-oxopyran-2-yl]-4,6-dimethylnon-6-en-2-yl]-6-ethyl-3,5-dimethylpyran-4-one (PubChem CID 163090432) has the molecular formula C32H48O7 and a molecular weight of 544.73 g/mol. Its IUPAC name is 2-[(E,2R,3R,4R,5S,8S)-3,5-dihydroxy-8-[6-[(2R,3R)-3-hydroxypentan-2-yl]-3,5-dimethyl-4-oxopyran-2-yl]-4,6-dimethylnon-6-en-2-yl]-6-ethyl-3,5-dimethylpyran-4-one.
| Compound Name | 2-[(E,2R,3R,4R,5S,8S)-3,5-dihydroxy-8-[6-[(2R,3R)-3-hydroxypentan-2-yl]-3,5-dimethyl-4-oxopyran-2-yl]-4,6-dimethylnon-6-en-2-yl]-6-ethyl-3,5-dimethylpyran-4-one |
|---|---|
| PubChem CID | 163090432 |
| Molecular Formula | C32H48O7 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | 2-[(E,2R,3R,4R,5S,8S)-3,5-dihydroxy-8-[6-[(2R,3R)-3-hydroxypentan-2-yl]-3,5-dimethyl-4-oxopyran-2-yl]-4,6-dimethylnon-6-en-2-yl]-6-ethyl-3,5-dimethylpyran-4-one |
| SMILES | CCc1oc([C@H](C)[C@H](O)[C@@H](C)[C@H](O)/C(C)=C/[C@H](C)c2oc([C@H](C)[C@H](O)CC)c(C)c(=O)c2C)c(C)c(=O)c1C |
| InChI | InChI=1S/C32H48O7/c1-12-24(33)17(5)31-23(11)29(37)20(8)30(39-31)16(4)14-15(3)26(34)19(7)28(36)22(10)32-21(9)27(35)18(6)25(13-2)38-32/h14,16-17,19,22,24,26,28,33-34,36H,12-13H2,1-11H3/b15-14+/t16-,17+,19-,22+,24+,26+,28+/m0/s1 |
| InChIKey | HLJUWPYOKLNZAF-IEUPIXRHSA-N |
| XLogP | 5.47 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|