C26H38O6 — CID 11453642
2-[(2S,3S,4S,5R,6R)-3,7-dihydroxy-5-[(4-methoxyphenyl)methoxy]-4,6-dimethylheptan-2-yl]-6-ethyl-3,5-dimethylpyran-4-one (PubChem CID 11453642) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is 2-[(2S,3S,4S,5R,6R)-3,7-dihydroxy-5-[(4-methoxyphenyl)methoxy]-4,6-dimethylheptan-2-yl]-6-ethyl-3,5-dimethylpyran-4-one.
| Compound Name | 2-[(2S,3S,4S,5R,6R)-3,7-dihydroxy-5-[(4-methoxyphenyl)methoxy]-4,6-dimethylheptan-2-yl]-6-ethyl-3,5-dimethylpyran-4-one |
|---|---|
| PubChem CID | 11453642 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 2-[(2S,3S,4S,5R,6R)-3,7-dihydroxy-5-[(4-methoxyphenyl)methoxy]-4,6-dimethylheptan-2-yl]-6-ethyl-3,5-dimethylpyran-4-one |
| SMILES | CCc1oc([C@@H](C)[C@@H](O)[C@H](C)[C@H](OCc2ccc(OC)cc2)[C@H](C)CO)c(C)c(=O)c1C |
| InChI | InChI=1S/C26H38O6/c1-8-22-16(3)23(28)18(5)26(32-22)19(6)24(29)17(4)25(15(2)13-27)31-14-20-9-11-21(30-7)12-10-20/h9-12,15,17,19,24-25,27,29H,8,13-14H2,1-7H3/t15-,17+,19+,24+,25-/m1/s1 |
| InChIKey | ADYOZBRVLOVQFZ-WYXGAPDESA-N |
| XLogP | 4.14 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |