C22H28O4 — CID 11013724
(2R,3S,4R)-4-(6-ethyl-3,5-dimethyl-4-oxopyran-2-yl)-2-methyl-3-phenylmethoxypentanal (PubChem CID 11013724) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is (2R,3S,4R)-4-(6-ethyl-3,5-dimethyl-4-oxopyran-2-yl)-2-methyl-3-phenylmethoxypentanal.
| Compound Name | (2R,3S,4R)-4-(6-ethyl-3,5-dimethyl-4-oxopyran-2-yl)-2-methyl-3-phenylmethoxypentanal |
|---|---|
| PubChem CID | 11013724 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (2R,3S,4R)-4-(6-ethyl-3,5-dimethyl-4-oxopyran-2-yl)-2-methyl-3-phenylmethoxypentanal |
| SMILES | CCc1oc([C@H](C)[C@H](OCc2ccccc2)[C@@H](C)C=O)c(C)c(=O)c1C |
| InChI | InChI=1S/C22H28O4/c1-6-19-15(3)20(24)16(4)22(26-19)17(5)21(14(2)12-23)25-13-18-10-8-7-9-11-18/h7-12,14,17,21H,6,13H2,1-5H3/t14-,17+,21+/m0/s1 |
| InChIKey | DIGCMWNAJSTRQS-AVBTWRTFSA-N |
| XLogP | 4.34 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|