C22H36O4 — CID 170356140
11-(5-ethyl-3,6-dimethyl-4-oxopyran-2-yl)undecan-2-yl acetate (PubChem CID 170356140) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is 11-(5-ethyl-3,6-dimethyl-4-oxopyran-2-yl)undecan-2-yl acetate.
| Compound Name | 11-(5-ethyl-3,6-dimethyl-4-oxopyran-2-yl)undecan-2-yl acetate |
|---|---|
| PubChem CID | 170356140 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 11-(5-ethyl-3,6-dimethyl-4-oxopyran-2-yl)undecan-2-yl acetate |
| SMILES | CCc1c(C)oc(CCCCCCCCCC(C)OC(C)=O)c(C)c1=O |
| InChI | InChI=1S/C22H36O4/c1-6-20-18(4)26-21(17(3)22(20)24)15-13-11-9-7-8-10-12-14-16(2)25-19(5)23/h16H,6-15H2,1-5H3 |
| InChIKey | AEWTYIZCAIIUHG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|