C27H48NO5+ — CID 156962920
[3-carboxy-2-[7-(5-heptyl-3,4-dimethylfuran-2-yl)heptanoyloxy]propyl]-trimethylazanium (PubChem CID 156962920) has the molecular formula C27H48NO5+ and a molecular weight of 466.68 g/mol. Its IUPAC name is [3-carboxy-2-[7-(5-heptyl-3,4-dimethylfuran-2-yl)heptanoyloxy]propyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[7-(5-heptyl-3,4-dimethylfuran-2-yl)heptanoyloxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962920 |
| Molecular Formula | C27H48NO5+ |
| Molecular Weight | 466.68 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | [3-carboxy-2-[7-(5-heptyl-3,4-dimethylfuran-2-yl)heptanoyloxy]propyl]-trimethylazanium |
| SMILES | CCCCCCCc1oc(CCCCCCC(=O)OC(CC(=O)O)C[N+](C)(C)C)c(C)c1C |
| InChI | InChI=1S/C27H47NO5/c1-7-8-9-10-13-16-24-21(2)22(3)25(33-24)17-14-11-12-15-18-27(31)32-23(19-26(29)30)20-28(4,5)6/h23H,7-20H2,1-6H3/p+1 |
| InChIKey | QSYNRUIUSDYKLH-UHFFFAOYSA-O |
| XLogP | 6.00 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.68 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|