C21H36NO5+ — CID 156962904
[3-carboxy-2-[3-(3,4-dimethyl-5-pentylfuran-2-yl)propanoyloxy]propyl]-trimethylazanium (PubChem CID 156962904) has the molecular formula C21H36NO5+ and a molecular weight of 382.52 g/mol. Its IUPAC name is [3-carboxy-2-[3-(3,4-dimethyl-5-pentylfuran-2-yl)propanoyloxy]propyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[3-(3,4-dimethyl-5-pentylfuran-2-yl)propanoyloxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962904 |
| Molecular Formula | C21H36NO5+ |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | [3-carboxy-2-[3-(3,4-dimethyl-5-pentylfuran-2-yl)propanoyloxy]propyl]-trimethylazanium |
| SMILES | CCCCCc1oc(CCC(=O)OC(CC(=O)O)C[N+](C)(C)C)c(C)c1C |
| InChI | InChI=1S/C21H35NO5/c1-7-8-9-10-18-15(2)16(3)19(27-18)11-12-21(25)26-17(13-20(23)24)14-22(4,5)6/h17H,7-14H2,1-6H3/p+1 |
| InChIKey | GMRMNULNTDRNAM-UHFFFAOYSA-O |
| XLogP | 3.65 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|