C24H42NO5+ — CID 156962928
[3-carboxy-2-[7-(3-methyl-5-pentylfuran-2-yl)heptanoyloxy]propyl]-trimethylazanium (PubChem CID 156962928) has the molecular formula C24H42NO5+ and a molecular weight of 424.60 g/mol. Its IUPAC name is [3-carboxy-2-[7-(3-methyl-5-pentylfuran-2-yl)heptanoyloxy]propyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[7-(3-methyl-5-pentylfuran-2-yl)heptanoyloxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962928 |
| Molecular Formula | C24H42NO5+ |
| Molecular Weight | 424.60 g/mol |
| Exact Mass | 424.31 |
| IUPAC Name | [3-carboxy-2-[7-(3-methyl-5-pentylfuran-2-yl)heptanoyloxy]propyl]-trimethylazanium |
| SMILES | CCCCCc1cc(C)c(CCCCCCC(=O)OC(CC(=O)O)C[N+](C)(C)C)o1 |
| InChI | InChI=1S/C24H41NO5/c1-6-7-10-13-20-16-19(2)22(29-20)14-11-8-9-12-15-24(28)30-21(17-23(26)27)18-25(3,4)5/h16,21H,6-15,17-18H2,1-5H3/p+1 |
| InChIKey | QCYYHMCHHDXYAS-UHFFFAOYSA-O |
| XLogP | 4.91 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|