C24H41NO5 — CID 156962867
3-[9-(3-methyl-5-propylfuran-2-yl)nonanoyloxy]-4-(trimethylazaniumyl)butanoate (PubChem CID 156962867) has the molecular formula C24H41NO5 and a molecular weight of 423.59 g/mol. Its IUPAC name is 3-[9-(3-methyl-5-propylfuran-2-yl)nonanoyloxy]-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[9-(3-methyl-5-propylfuran-2-yl)nonanoyloxy]-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156962867 |
| Molecular Formula | C24H41NO5 |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | 3-[9-(3-methyl-5-propylfuran-2-yl)nonanoyloxy]-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCc1cc(C)c(CCCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C)o1 |
| InChI | InChI=1S/C24H41NO5/c1-6-13-20-16-19(2)22(29-20)14-11-9-7-8-10-12-15-24(28)30-21(17-23(26)27)18-25(3,4)5/h16,21H,6-15,17-18H2,1-5H3 |
| InChIKey | LRPRBZLVQGHZNL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|