C26H45NO5 — CID 156962929
3-[8-(3,4-dimethyl-5-pentylfuran-2-yl)octanoyloxy]-4-(trimethylazaniumyl)butanoate (PubChem CID 156962929) has the molecular formula C26H45NO5 and a molecular weight of 451.65 g/mol. Its IUPAC name is 3-[8-(3,4-dimethyl-5-pentylfuran-2-yl)octanoyloxy]-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[8-(3,4-dimethyl-5-pentylfuran-2-yl)octanoyloxy]-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156962929 |
| Molecular Formula | C26H45NO5 |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.33 |
| IUPAC Name | 3-[8-(3,4-dimethyl-5-pentylfuran-2-yl)octanoyloxy]-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCc1oc(CCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C)c(C)c1C |
| InChI | InChI=1S/C26H45NO5/c1-7-8-12-15-23-20(2)21(3)24(32-23)16-13-10-9-11-14-17-26(30)31-22(18-25(28)29)19-27(4,5)6/h22H,7-19H2,1-6H3 |
| InChIKey | ZORYYMPAXYCNJH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|