C22H37NO5 — CID 156962909
3-[5-(3-methyl-5-pentylfuran-2-yl)pentanoyloxy]-4-(trimethylazaniumyl)butanoate (PubChem CID 156962909) has the molecular formula C22H37NO5 and a molecular weight of 395.54 g/mol. Its IUPAC name is 3-[5-(3-methyl-5-pentylfuran-2-yl)pentanoyloxy]-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[5-(3-methyl-5-pentylfuran-2-yl)pentanoyloxy]-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156962909 |
| Molecular Formula | C22H37NO5 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | 3-[5-(3-methyl-5-pentylfuran-2-yl)pentanoyloxy]-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCc1cc(C)c(CCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C)o1 |
| InChI | InChI=1S/C22H37NO5/c1-6-7-8-11-18-14-17(2)20(27-18)12-9-10-13-22(26)28-19(15-21(24)25)16-23(3,4)5/h14,19H,6-13,15-16H2,1-5H3 |
| InChIKey | WNMAPJVCDOSOAC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|