C10H20N2S — CID 127514774
1-cyclohexyl-1,3,3-trimethylthiourea (PubChem CID 127514774) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is 1-cyclohexyl-1,3,3-trimethylthiourea.
| Compound Name | 1-cyclohexyl-1,3,3-trimethylthiourea |
|---|---|
| PubChem CID | 127514774 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 1-cyclohexyl-1,3,3-trimethylthiourea |
| SMILES | CN(C)C(=S)N(C)C1CCCCC1 |
| InChI | InChI=1S/C10H20N2S/c1-11(2)10(13)12(3)9-7-5-4-6-8-9/h9H,4-8H2,1-3H3 |
| InChIKey | SCNXSXQUWIZEEZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|