C19H24N2O4 — CID 12751722
2-(4-methoxyphenyl)-3-[2-(4-methoxyphenyl)hydrazinyl]-3-methylbutanoic acid (PubChem CID 12751722) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-3-[2-(4-methoxyphenyl)hydrazinyl]-3-methylbutanoic acid.
| Compound Name | 2-(4-methoxyphenyl)-3-[2-(4-methoxyphenyl)hydrazinyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 12751722 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-(4-methoxyphenyl)-3-[2-(4-methoxyphenyl)hydrazinyl]-3-methylbutanoic acid |
| SMILES | COc1ccc(NNC(C)(C)C(C(=O)O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H24N2O4/c1-19(2,21-20-14-7-11-16(25-4)12-8-14)17(18(22)23)13-5-9-15(24-3)10-6-13/h5-12,17,20-21H,1-4H3,(H,22,23) |
| InChIKey | JGZLZNUVTBVVNQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|