C19H28O5 — CID 154389531
3-(4-methoxyphenyl)-2,2-bis(2-methylpropyl)butanedioic acid (PubChem CID 154389531) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2,2-bis(2-methylpropyl)butanedioic acid.
| Compound Name | 3-(4-methoxyphenyl)-2,2-bis(2-methylpropyl)butanedioic acid |
|---|---|
| PubChem CID | 154389531 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 3-(4-methoxyphenyl)-2,2-bis(2-methylpropyl)butanedioic acid |
| SMILES | COc1ccc(C(C(=O)O)C(CC(C)C)(CC(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C19H28O5/c1-12(2)10-19(18(22)23,11-13(3)4)16(17(20)21)14-6-8-15(24-5)9-7-14/h6-9,12-13,16H,10-11H2,1-5H3,(H,20,21)(H,22,23) |
| InChIKey | FSOJLYKMDFSYKC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |