C21H28FN3O2 — CID 127603569
2-(6-fluoro-1H-indol-3-yl)-N-[1-(2-hydroxycyclohexyl)piperidin-4-yl]acetamide (PubChem CID 127603569) has the molecular formula C21H28FN3O2 and a molecular weight of 373.47 g/mol. Its IUPAC name is 2-(6-fluoro-1H-indol-3-yl)-N-[1-(2-hydroxycyclohexyl)piperidin-4-yl]acetamide.
| Compound Name | 2-(6-fluoro-1H-indol-3-yl)-N-[1-(2-hydroxycyclohexyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 127603569 |
| Molecular Formula | C21H28FN3O2 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 2-(6-fluoro-1H-indol-3-yl)-N-[1-(2-hydroxycyclohexyl)piperidin-4-yl]acetamide |
| SMILES | O=C(Cc1c[nH]c2cc(F)ccc12)NC1CCN(C2CCCCC2O)CC1 |
| InChI | InChI=1S/C21H28FN3O2/c22-15-5-6-17-14(13-23-18(17)12-15)11-21(27)24-16-7-9-25(10-8-16)19-3-1-2-4-20(19)26/h5-6,12-13,16,19-20,23,26H,1-4,7-11H2,(H,24,27) |
| InChIKey | JOSGJMRBJRYZFT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |