C13H15N3O3 — CID 12764429
1-(4-nitro-1,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)ethanone (PubChem CID 12764429) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 1-(4-nitro-1,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)ethanone.
| Compound Name | 1-(4-nitro-1,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)ethanone |
|---|---|
| PubChem CID | 12764429 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 1-(4-nitro-1,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)ethanone |
| SMILES | CC(=O)N1CCN2CC1Cc1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C13H15N3O3/c1-9(17)15-5-4-14-8-12(15)6-10-2-3-11(16(18)19)7-13(10)14/h2-3,7,12H,4-6,8H2,1H3 |
| InChIKey | RIDSAXOLYXKDAV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|