C14H12BrN3O3S — CID 12778060
O-[2-(3-bromo-2-pyridinyl)-4-nitrophenyl] N,N-dimethylcarbamothioate (PubChem CID 12778060) has the molecular formula C14H12BrN3O3S and a molecular weight of 382.24 g/mol. Its IUPAC name is O-[2-(3-bromo-2-pyridinyl)-4-nitrophenyl] N,N-dimethylcarbamothioate.
| Compound Name | O-[2-(3-bromo-2-pyridinyl)-4-nitrophenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 12778060 |
| Molecular Formula | C14H12BrN3O3S |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | O-[2-(3-bromo-2-pyridinyl)-4-nitrophenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=S)Oc1ccc([N+](=O)[O-])cc1-c1ncccc1Br |
| InChI | InChI=1S/C14H12BrN3O3S/c1-17(2)14(22)21-12-6-5-9(18(19)20)8-10(12)13-11(15)4-3-7-16-13/h3-8H,1-2H3 |
| InChIKey | BDZRVOLSOBBMDV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|