C18H38O2Si2 — CID 12786191
triethyl-(2-prop-2-ynyl-2-trimethylsilyloxyhexoxy)silane (PubChem CID 12786191) has the molecular formula C18H38O2Si2 and a molecular weight of 342.67 g/mol. Its IUPAC name is triethyl-(2-prop-2-ynyl-2-trimethylsilyloxyhexoxy)silane.
| Compound Name | triethyl-(2-prop-2-ynyl-2-trimethylsilyloxyhexoxy)silane |
|---|---|
| PubChem CID | 12786191 |
| Molecular Formula | C18H38O2Si2 |
| Molecular Weight | 342.67 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | triethyl-(2-prop-2-ynyl-2-trimethylsilyloxyhexoxy)silane |
| SMILES | C#CCC(CCCC)(CO[Si](CC)(CC)CC)O[Si](C)(C)C |
| InChI | InChI=1S/C18H38O2Si2/c1-9-14-16-18(15-10-2,20-21(6,7)8)17-19-22(11-3,12-4)13-5/h2H,9,11-17H2,1,3-8H3 |
| InChIKey | GZFGESAOHNWUCP-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.67 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|