C17H34O4Si2 — CID 15965558
triethoxy-[2-(1-trimethylsilyloxycyclohexyl)ethynyl]silane (PubChem CID 15965558) has the molecular formula C17H34O4Si2 and a molecular weight of 358.63 g/mol. Its IUPAC name is triethoxy-[2-(1-trimethylsilyloxycyclohexyl)ethynyl]silane.
| Compound Name | triethoxy-[2-(1-trimethylsilyloxycyclohexyl)ethynyl]silane |
|---|---|
| PubChem CID | 15965558 |
| Molecular Formula | C17H34O4Si2 |
| Molecular Weight | 358.63 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | triethoxy-[2-(1-trimethylsilyloxycyclohexyl)ethynyl]silane |
| SMILES | CCO[Si](C#CC1(O[Si](C)(C)C)CCCCC1)(OCC)OCC |
| InChI | InChI=1S/C17H34O4Si2/c1-7-18-23(19-8-2,20-9-3)16-15-17(21-22(4,5)6)13-11-10-12-14-17/h7-14H2,1-6H3 |
| InChIKey | HCQTZUFPRMJKON-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|