C23H46OSi2 — CID 134943942
tert-butyl-dimethyl-[(1R,3S)-3-[2-tri(propan-2-yl)silylethynyl]cyclohexyl]oxysilane (PubChem CID 134943942) has the molecular formula C23H46OSi2 and a molecular weight of 394.79 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,3S)-3-[2-tri(propan-2-yl)silylethynyl]cyclohexyl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R,3S)-3-[2-tri(propan-2-yl)silylethynyl]cyclohexyl]oxysilane |
|---|---|
| PubChem CID | 134943942 |
| Molecular Formula | C23H46OSi2 |
| Molecular Weight | 394.79 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,3S)-3-[2-tri(propan-2-yl)silylethynyl]cyclohexyl]oxysilane |
| SMILES | CC(C)[Si](C#C[C@H]1CCC[C@@H](O[Si](C)(C)C(C)(C)C)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H46OSi2/c1-18(2)26(19(3)4,20(5)6)16-15-21-13-12-14-22(17-21)24-25(10,11)23(7,8)9/h18-22H,12-14,17H2,1-11H3/t21-,22-/m1/s1 |
| InChIKey | ZUBTZYDHLNRJLO-FGZHOGPDSA-N |
| XLogP | 7.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.79 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|