C14H32OSi2 — CID 589987
(3,5-dimethylcyclohexyl)oxy-dimethyl-(trimethylsilylmethyl)silane (PubChem CID 589987) has the molecular formula C14H32OSi2 and a molecular weight of 272.58 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl)oxy-dimethyl-(trimethylsilylmethyl)silane.
| Compound Name | (3,5-dimethylcyclohexyl)oxy-dimethyl-(trimethylsilylmethyl)silane |
|---|---|
| PubChem CID | 589987 |
| Molecular Formula | C14H32OSi2 |
| Molecular Weight | 272.58 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (3,5-dimethylcyclohexyl)oxy-dimethyl-(trimethylsilylmethyl)silane |
| SMILES | CC1CC(C)CC(O[Si](C)(C)C[Si](C)(C)C)C1 |
| InChI | InChI=1S/C14H32OSi2/c1-12-8-13(2)10-14(9-12)15-17(6,7)11-16(3,4)5/h12-14H,8-11H2,1-7H3 |
| InChIKey | UCEHQJUBQILCAV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|