C10H10ClNO2 — CID 12786641
2-(5-chloro-2-methoxyphenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 12786641) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 12786641 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | COc1ccc(Cl)cc1C1=NCCO1 |
| InChI | InChI=1S/C10H10ClNO2/c1-13-9-3-2-7(11)6-8(9)10-12-4-5-14-10/h2-3,6H,4-5H2,1H3 |
| InChIKey | MMAQGNVNYLWYTB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |