C12H15NO4 — CID 160797416
2-(2,3,4-trimethoxyphenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 160797416) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-(2,3,4-trimethoxyphenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(2,3,4-trimethoxyphenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 160797416 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-(2,3,4-trimethoxyphenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | COc1ccc(C2=NCCO2)c(OC)c1OC |
| InChI | InChI=1S/C12H15NO4/c1-14-9-5-4-8(12-13-6-7-17-12)10(15-2)11(9)16-3/h4-5H,6-7H2,1-3H3 |
| InChIKey | CKHLHADKQRIXPU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |