C9H15N3OS — CID 12787602
2-methyl-3-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)propanethioamide (PubChem CID 12787602) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-methyl-3-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)propanethioamide.
| Compound Name | 2-methyl-3-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)propanethioamide |
|---|---|
| PubChem CID | 12787602 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-methyl-3-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)propanethioamide |
| SMILES | CC1=NN(CC(C)C(N)=S)C(=O)CC1 |
| InChI | InChI=1S/C9H15N3OS/c1-6(9(10)14)5-12-8(13)4-3-7(2)11-12/h6H,3-5H2,1-2H3,(H2,10,14) |
| InChIKey | MISUUNIXGMMAMT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|