C17H20N2O3 — CID 1279422
(1S,8R,9S)-N-(2-methyl-5-nitrophenyl)bicyclo[6.1.0]non-2-ene-9-carboxamide (PubChem CID 1279422) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is (1S,8R,9S)-N-(2-methyl-5-nitrophenyl)bicyclo[6.1.0]non-2-ene-9-carboxamide.
| Compound Name | (1S,8R,9S)-N-(2-methyl-5-nitrophenyl)bicyclo[6.1.0]non-2-ene-9-carboxamide |
|---|---|
| PubChem CID | 1279422 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (1S,8R,9S)-N-(2-methyl-5-nitrophenyl)bicyclo[6.1.0]non-2-ene-9-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H]1[C@H]2C=CCCCC[C@H]21 |
| InChI | InChI=1S/C17H20N2O3/c1-11-8-9-12(19(21)22)10-15(11)18-17(20)16-13-6-4-2-3-5-7-14(13)16/h4,6,8-10,13-14,16H,2-3,5,7H2,1H3,(H,18,20)/t13-,14+,16+/m0/s1 |
| InChIKey | VSOZXAHPNMJONZ-SQWLQELKSA-N |
| XLogP | 3.83 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|