C15H23N3O3 — CID 127983336
4-[2-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-2-oxoethyl]-1-methylpiperazin-2-one (PubChem CID 127983336) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-[2-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-2-oxoethyl]-1-methylpiperazin-2-one.
| Compound Name | 4-[2-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-2-oxoethyl]-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 127983336 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 4-[2-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-2-oxoethyl]-1-methylpiperazin-2-one |
| SMILES | CN1CCN(CC(=O)N2CC3C4CCC(O4)C3C2)CC1=O |
| InChI | InChI=1S/C15H23N3O3/c1-16-4-5-17(8-14(16)19)9-15(20)18-6-10-11(7-18)13-3-2-12(10)21-13/h10-13H,2-9H2,1H3 |
| InChIKey | CYBGJSXZBCCIBC-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |