C15H21N7O2S2 — CID 12806004
N'-(4-aminophenyl)sulfonyl-5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pentanimidamide (PubChem CID 12806004) has the molecular formula C15H21N7O2S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N'-(4-aminophenyl)sulfonyl-5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pentanimidamide.
| Compound Name | N'-(4-aminophenyl)sulfonyl-5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pentanimidamide |
|---|---|
| PubChem CID | 12806004 |
| Molecular Formula | C15H21N7O2S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N'-(4-aminophenyl)sulfonyl-5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pentanimidamide |
| SMILES | NC(N)=Nc1nc(CCCC/C(N)=N/S(=O)(=O)c2ccc(N)cc2)cs1 |
| InChI | InChI=1S/C15H21N7O2S2/c16-10-5-7-12(8-6-10)26(23,24)22-13(17)4-2-1-3-11-9-25-15(20-11)21-14(18)19/h5-9H,1-4,16H2,(H2,17,22)(H4,18,19,20,21) |
| InChIKey | LZTVMCHDSASKII-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 175.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|