C15H20N6O2S2 — CID 12806006
N'-(benzenesulfonyl)-5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pentanimidamide (PubChem CID 12806006) has the molecular formula C15H20N6O2S2 and a molecular weight of 380.50 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pentanimidamide.
| Compound Name | N'-(benzenesulfonyl)-5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pentanimidamide |
|---|---|
| PubChem CID | 12806006 |
| Molecular Formula | C15H20N6O2S2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N'-(benzenesulfonyl)-5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pentanimidamide |
| SMILES | NC(N)=Nc1nc(CCCC/C(N)=N/S(=O)(=O)c2ccccc2)cs1 |
| InChI | InChI=1S/C15H20N6O2S2/c16-13(21-25(22,23)12-7-2-1-3-8-12)9-5-4-6-11-10-24-15(19-11)20-14(17)18/h1-3,7-8,10H,4-6,9H2,(H2,16,21)(H4,17,18,19,20) |
| InChIKey | PNMMCQREWCZHMQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 149.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|