C15H21N7O2S3 — CID 12881451
N'-(benzylsulfamoyl)-3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]propanimidamide (PubChem CID 12881451) has the molecular formula C15H21N7O2S3 and a molecular weight of 427.58 g/mol. Its IUPAC name is N'-(benzylsulfamoyl)-3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]propanimidamide.
| Compound Name | N'-(benzylsulfamoyl)-3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]propanimidamide |
|---|---|
| PubChem CID | 12881451 |
| Molecular Formula | C15H21N7O2S3 |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | N'-(benzylsulfamoyl)-3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]propanimidamide |
| SMILES | NC(N)=Nc1nc(CSCC/C(N)=N/S(=O)(=O)NCc2ccccc2)cs1 |
| InChI | InChI=1S/C15H21N7O2S3/c16-13(22-27(23,24)19-8-11-4-2-1-3-5-11)6-7-25-9-12-10-26-15(20-12)21-14(17)18/h1-5,10,19H,6-9H2,(H2,16,22)(H4,17,18,20,21) |
| InChIKey | GPKFYUOPPKTXPG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|