C15H21N7O2S2 — CID 12806016
N'-(benzenesulfonamido)-5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pentanimidamide (PubChem CID 12806016) has the molecular formula C15H21N7O2S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N'-(benzenesulfonamido)-5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pentanimidamide.
| Compound Name | N'-(benzenesulfonamido)-5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pentanimidamide |
|---|---|
| PubChem CID | 12806016 |
| Molecular Formula | C15H21N7O2S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N'-(benzenesulfonamido)-5-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pentanimidamide |
| SMILES | NC(N)=Nc1nc(CCCC/C(N)=N/NS(=O)(=O)c2ccccc2)cs1 |
| InChI | InChI=1S/C15H21N7O2S2/c16-13(21-22-26(23,24)12-7-2-1-3-8-12)9-5-4-6-11-10-25-15(19-11)20-14(17)18/h1-3,7-8,10,22H,4-6,9H2,(H2,16,21)(H4,17,18,19,20) |
| InChIKey | FDIFWYQEJAEQBC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|