About sodium 9-phenylfluoren-9-ide
sodium 9-phenylfluoren-9-ide (PubChem CID 12807151) has the molecular formula C19H13Na
and a molecular weight of 264.30 g/mol. Its IUPAC name is sodium 9-phenylfluoren-9-ide.
Molecular Properties
| Compound Name | sodium 9-phenylfluoren-9-ide |
| PubChem CID | 12807151 |
| Molecular Formula | C19H13Na |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | sodium 9-phenylfluoren-9-ide |
| SMILES | [Na+].c1ccc(-[c-]2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C19H13.Na/c1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19;/h1-13H;/q-1;+1 |
| InChIKey | XQDVFVMKYIHTIS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium 9-phenylfluoren-9-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 9-phenylfluoren-9-ide?
The IUPAC name of sodium 9-phenylfluoren-9-ide (CID 12807151) is sodium 9-phenylfluoren-9-ide.
What is the SMILES notation for sodium 9-phenylfluoren-9-ide?
The canonical SMILES for sodium 9-phenylfluoren-9-ide is [Na+].c1ccc(-[c-]2c3ccccc3c3ccccc32)cc1.
What is the InChIKey of sodium 9-phenylfluoren-9-ide?
The InChIKey is XQDVFVMKYIHTIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13.Na/c1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19;/h1-13H;/q-1;+1.
What are the key properties of sodium 9-phenylfluoren-9-ide?
sodium 9-phenylfluoren-9-ide has a molecular weight of 264.30 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 9-phenylfluoren-9-ide is sourced from PubChem (CID 12807151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).