sodium 9-phenylfluoren-9-ide

C19H13Na — CID 12807151

IUPACsodium 9-phenylfluoren-9-ide
SMILES[Na+].c1ccc(-[c-]2c3ccccc3c3ccccc32)cc1
InChIInChI=1S/C19H13.Na/c1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19;/h1-13H;/q-1;+1
InChIKeyXQDVFVMKYIHTIS-UHFFFAOYSA-N
MW264.30 g/mol
LogP2.38
Rot. Bonds1

About sodium 9-phenylfluoren-9-ide

sodium 9-phenylfluoren-9-ide (PubChem CID 12807151) has the molecular formula C19H13Na and a molecular weight of 264.30 g/mol. Its IUPAC name is sodium 9-phenylfluoren-9-ide.

Molecular Properties

Compound Namesodium 9-phenylfluoren-9-ide
PubChem CID12807151
Molecular FormulaC19H13Na
Molecular Weight264.30 g/mol
Exact Mass264.09
IUPAC Namesodium 9-phenylfluoren-9-ide
SMILES[Na+].c1ccc(-[c-]2c3ccccc3c3ccccc32)cc1
InChIInChI=1S/C19H13.Na/c1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19;/h1-13H;/q-1;+1
InChIKeyXQDVFVMKYIHTIS-UHFFFAOYSA-N
XLogP2.38
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds1
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.30
LogP ≤ 52.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}

Analyze sodium 9-phenylfluoren-9-ide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 9-phenylfluoren-9-ide?
The IUPAC name of sodium 9-phenylfluoren-9-ide (CID 12807151) is sodium 9-phenylfluoren-9-ide.
What is the SMILES notation for sodium 9-phenylfluoren-9-ide?
The canonical SMILES for sodium 9-phenylfluoren-9-ide is [Na+].c1ccc(-[c-]2c3ccccc3c3ccccc32)cc1.
What is the InChIKey of sodium 9-phenylfluoren-9-ide?
The InChIKey is XQDVFVMKYIHTIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13.Na/c1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19;/h1-13H;/q-1;+1.
What are the key properties of sodium 9-phenylfluoren-9-ide?
sodium 9-phenylfluoren-9-ide has a molecular weight of 264.30 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 9-phenylfluoren-9-ide is sourced from PubChem (CID 12807151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).