C22H19ClN2O5 — CID 12808404
4-(2,6-diphenylpyran-4-ylidene)-3,5-dimethylpyrazol-1-ium perchlorate (PubChem CID 12808404) has the molecular formula C22H19ClN2O5 and a molecular weight of 426.86 g/mol. Its IUPAC name is 4-(2,6-diphenylpyran-4-ylidene)-3,5-dimethylpyrazol-1-ium perchlorate.
| Compound Name | 4-(2,6-diphenylpyran-4-ylidene)-3,5-dimethylpyrazol-1-ium perchlorate |
|---|---|
| PubChem CID | 12808404 |
| Molecular Formula | C22H19ClN2O5 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 4-(2,6-diphenylpyran-4-ylidene)-3,5-dimethylpyrazol-1-ium perchlorate |
| SMILES | CC1=N[NH+]=C(C)C1=C1C=C(c2ccccc2)OC(c2ccccc2)=C1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H18N2O.ClHO4/c1-15-22(16(2)24-23-15)19-13-20(17-9-5-3-6-10-17)25-21(14-19)18-11-7-4-8-12-18;2-1(3,4)5/h3-14H,1-2H3;(H,2,3,4,5) |
| InChIKey | DKAMFVHXCZLKDR-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |